C23H20ClFN4O2 — CID 66570911
2-[3-chloro-7-[(6-fluoroquinoxalin-2-yl)-methylamino]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid (PubChem CID 66570911) has the molecular formula C23H20ClFN4O2 and a molecular weight of 438.89 g/mol. Its IUPAC name is 2-[3-chloro-7-[(6-fluoroquinoxalin-2-yl)-methylamino]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid.
| Compound Name | 2-[3-chloro-7-[(6-fluoroquinoxalin-2-yl)-methylamino]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid |
|---|---|
| PubChem CID | 66570911 |
| Molecular Formula | C23H20ClFN4O2 |
| Molecular Weight | 438.89 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 2-[3-chloro-7-[(6-fluoroquinoxalin-2-yl)-methylamino]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid |
| SMILES | CN(c1cnc2cc(F)ccc2n1)C1CCc2c(CC(=O)O)c3ccc(Cl)cc3n2C1 |
| InChI | InChI=1S/C23H20ClFN4O2/c1-28(22-11-26-19-9-14(25)3-6-18(19)27-22)15-4-7-20-17(10-23(30)31)16-5-2-13(24)8-21(16)29(20)12-15/h2-3,5-6,8-9,11,15H,4,7,10,12H2,1H3,(H,30,31) |
| InChIKey | YDDOYBKUNHZOGI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.89 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|