C26H48O2Si — CID 66575495
tert-butyl-dimethyl-[(1S,6R)-3-methyl-6-[(2S)-4-[(1R,2R,3R,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]butan-2-yl]cyclohex-2-en-1-yl]oxysilane (PubChem CID 66575495) has the molecular formula C26H48O2Si and a molecular weight of 420.75 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1S,6R)-3-methyl-6-[(2S)-4-[(1R,2R,3R,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]butan-2-yl]cyclohex-2-en-1-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1S,6R)-3-methyl-6-[(2S)-4-[(1R,2R,3R,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]butan-2-yl]cyclohex-2-en-1-yl]oxysilane |
|---|---|
| PubChem CID | 66575495 |
| Molecular Formula | C26H48O2Si |
| Molecular Weight | 420.75 g/mol |
| Exact Mass | 420.34 |
| IUPAC Name | tert-butyl-dimethyl-[(1S,6R)-3-methyl-6-[(2S)-4-[(1R,2R,3R,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]butan-2-yl]cyclohex-2-en-1-yl]oxysilane |
| SMILES | CC1=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]([C@@H](C)CC[C@@H]2[C@@H](C)[C@]3(C)CC[C@@]2(C)O3)CC1 |
| InChI | InChI=1S/C26H48O2Si/c1-18-11-13-21(23(17-18)27-29(9,10)24(4,5)6)19(2)12-14-22-20(3)25(7)15-16-26(22,8)28-25/h17,19-23H,11-16H2,1-10H3/t19-,20+,21+,22+,23+,25-,26+/m0/s1 |
| InChIKey | YJYFITYXRNYEKT-RFNZRWNMSA-N |
| XLogP | 7.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.75 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|