C23H42O2Si — CID 11188127
tert-butyl-dimethyl-[(E)-3-[(1S,2S,5R)-5-methyl-1-prop-2-enoxy-2-prop-1-en-2-ylcyclohexyl]but-2-enoxy]silane (PubChem CID 11188127) has the molecular formula C23H42O2Si and a molecular weight of 378.67 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E)-3-[(1S,2S,5R)-5-methyl-1-prop-2-enoxy-2-prop-1-en-2-ylcyclohexyl]but-2-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(E)-3-[(1S,2S,5R)-5-methyl-1-prop-2-enoxy-2-prop-1-en-2-ylcyclohexyl]but-2-enoxy]silane |
|---|---|
| PubChem CID | 11188127 |
| Molecular Formula | C23H42O2Si |
| Molecular Weight | 378.67 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | tert-butyl-dimethyl-[(E)-3-[(1S,2S,5R)-5-methyl-1-prop-2-enoxy-2-prop-1-en-2-ylcyclohexyl]but-2-enoxy]silane |
| SMILES | C=CCO[C@@]1(/C(C)=C/CO[Si](C)(C)C(C)(C)C)C[C@H](C)CC[C@H]1C(=C)C |
| InChI | InChI=1S/C23H42O2Si/c1-11-15-24-23(17-19(4)12-13-21(23)18(2)3)20(5)14-16-25-26(9,10)22(6,7)8/h11,14,19,21H,1-2,12-13,15-17H2,3-10H3/b20-14+/t19-,21+,23-/m1/s1 |
| InChIKey | GMSMYLAHHMWABG-ADCJFOLMSA-N |
| XLogP | 6.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.67 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|