C21H40O4Si — CID 10762625
[(1R,2S,5R)-1-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-5-methyl-2-propan-2-ylcyclohexyl] methyl carbonate (PubChem CID 10762625) has the molecular formula C21H40O4Si and a molecular weight of 384.63 g/mol. Its IUPAC name is [(1R,2S,5R)-1-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-5-methyl-2-propan-2-ylcyclohexyl] methyl carbonate.
| Compound Name | [(1R,2S,5R)-1-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-5-methyl-2-propan-2-ylcyclohexyl] methyl carbonate |
|---|---|
| PubChem CID | 10762625 |
| Molecular Formula | C21H40O4Si |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | [(1R,2S,5R)-1-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-5-methyl-2-propan-2-ylcyclohexyl] methyl carbonate |
| SMILES | COC(=O)O[C@@]1(/C=C/CO[Si](C)(C)C(C)(C)C)C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C21H40O4Si/c1-16(2)18-12-11-17(3)15-21(18,25-19(22)23-7)13-10-14-24-26(8,9)20(4,5)6/h10,13,16-18H,11-12,14-15H2,1-9H3/b13-10+/t17-,18+,21+/m1/s1 |
| InChIKey | OJWIWTDHBDYYPR-LGHPHGEPSA-N |
| XLogP | 6.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|