[2,5-dimethyl-1-[(E)-prop-1-enyl]cyclohexyl] methyl carbonate

C13H22O3 — CID 134854617

IUPAC[2,5-dimethyl-1-[(E)-prop-1-enyl]cyclohexyl] methyl carbonate
SMILESC/C=C/C1(OC(=O)OC)CC(C)CCC1C
InChIInChI=1S/C13H22O3/c1-5-8-13(16-12(14)15-4)9-10(2)6-7-11(13)3/h5,8,10-11H,6-7,9H2,1-4H3/b8-5+
InChIKeyIBQILNFGAMFRFK-VMPITWQZSA-N
MW226.32 g/mol
LogP3.54
Rot. Bonds2

About [2,5-dimethyl-1-[(E)-prop-1-enyl]cyclohexyl] methyl carbonate

[2,5-dimethyl-1-[(E)-prop-1-enyl]cyclohexyl] methyl carbonate (PubChem CID 134854617) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is [2,5-dimethyl-1-[(E)-prop-1-enyl]cyclohexyl] methyl carbonate.

Molecular Properties

Compound Name[2,5-dimethyl-1-[(E)-prop-1-enyl]cyclohexyl] methyl carbonate
PubChem CID134854617
Molecular FormulaC13H22O3
Molecular Weight226.32 g/mol
Exact Mass226.16
IUPAC Name[2,5-dimethyl-1-[(E)-prop-1-enyl]cyclohexyl] methyl carbonate
SMILESC/C=C/C1(OC(=O)OC)CC(C)CCC1C
InChIInChI=1S/C13H22O3/c1-5-8-13(16-12(14)15-4)9-10(2)6-7-11(13)3/h5,8,10-11H,6-7,9H2,1-4H3/b8-5+
InChIKeyIBQILNFGAMFRFK-VMPITWQZSA-N
XLogP3.54
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.32
LogP ≤ 53.54
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze [2,5-dimethyl-1-[(E)-prop-1-enyl]cyclohexyl] methyl carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2,5-dimethyl-1-[(E)-prop-1-enyl]cyclohexyl] methyl carbonate?
The IUPAC name of [2,5-dimethyl-1-[(E)-prop-1-enyl]cyclohexyl] methyl carbonate (CID 134854617) is [2,5-dimethyl-1-[(E)-prop-1-enyl]cyclohexyl] methyl carbonate.
What is the SMILES notation for [2,5-dimethyl-1-[(E)-prop-1-enyl]cyclohexyl] methyl carbonate?
The canonical SMILES for [2,5-dimethyl-1-[(E)-prop-1-enyl]cyclohexyl] methyl carbonate is C/C=C/C1(OC(=O)OC)CC(C)CCC1C.
What is the InChIKey of [2,5-dimethyl-1-[(E)-prop-1-enyl]cyclohexyl] methyl carbonate?
The InChIKey is IBQILNFGAMFRFK-VMPITWQZSA-N. The full InChI is InChI=1S/C13H22O3/c1-5-8-13(16-12(14)15-4)9-10(2)6-7-11(13)3/h5,8,10-11H,6-7,9H2,1-4H3/b8-5+.
What are the key properties of [2,5-dimethyl-1-[(E)-prop-1-enyl]cyclohexyl] methyl carbonate?
[2,5-dimethyl-1-[(E)-prop-1-enyl]cyclohexyl] methyl carbonate has a molecular weight of 226.32 g/mol, XLogP of 3.54, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,5-dimethyl-1-[(E)-prop-1-enyl]cyclohexyl] methyl carbonate is sourced from PubChem (CID 134854617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).