C13H22O3 — CID 134854617
[2,5-dimethyl-1-[(E)-prop-1-enyl]cyclohexyl] methyl carbonate (PubChem CID 134854617) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is [2,5-dimethyl-1-[(E)-prop-1-enyl]cyclohexyl] methyl carbonate.
| Compound Name | [2,5-dimethyl-1-[(E)-prop-1-enyl]cyclohexyl] methyl carbonate |
|---|---|
| PubChem CID | 134854617 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | [2,5-dimethyl-1-[(E)-prop-1-enyl]cyclohexyl] methyl carbonate |
| SMILES | C/C=C/C1(OC(=O)OC)CC(C)CCC1C |
| InChI | InChI=1S/C13H22O3/c1-5-8-13(16-12(14)15-4)9-10(2)6-7-11(13)3/h5,8,10-11H,6-7,9H2,1-4H3/b8-5+ |
| InChIKey | IBQILNFGAMFRFK-VMPITWQZSA-N |
| XLogP | 3.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|