C18H32O3 — CID 15359435
[(1R,2S,5R)-1-[(E)-hex-1-enyl]-5-methyl-2-propan-2-ylcyclohexyl] methyl carbonate (PubChem CID 15359435) has the molecular formula C18H32O3 and a molecular weight of 296.45 g/mol. Its IUPAC name is [(1R,2S,5R)-1-[(E)-hex-1-enyl]-5-methyl-2-propan-2-ylcyclohexyl] methyl carbonate.
| Compound Name | [(1R,2S,5R)-1-[(E)-hex-1-enyl]-5-methyl-2-propan-2-ylcyclohexyl] methyl carbonate |
|---|---|
| PubChem CID | 15359435 |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | [(1R,2S,5R)-1-[(E)-hex-1-enyl]-5-methyl-2-propan-2-ylcyclohexyl] methyl carbonate |
| SMILES | CCCC/C=C/[C@]1(OC(=O)OC)C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C18H32O3/c1-6-7-8-9-12-18(21-17(19)20-5)13-15(4)10-11-16(18)14(2)3/h9,12,14-16H,6-8,10-11,13H2,1-5H3/b12-9+/t15-,16+,18+/m1/s1 |
| InChIKey | FIVWQXOZKSUPOK-DHMDNTQVSA-N |
| XLogP | 5.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|