C19H38O2Si — CID 10639867
(1R,2S,5R)-1-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-5-methyl-2-propan-2-ylcyclohexan-1-ol (PubChem CID 10639867) has the molecular formula C19H38O2Si and a molecular weight of 326.60 g/mol. Its IUPAC name is (1R,2S,5R)-1-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-5-methyl-2-propan-2-ylcyclohexan-1-ol.
| Compound Name | (1R,2S,5R)-1-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-5-methyl-2-propan-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 10639867 |
| Molecular Formula | C19H38O2Si |
| Molecular Weight | 326.60 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | (1R,2S,5R)-1-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-5-methyl-2-propan-2-ylcyclohexan-1-ol |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@@]1(O)/C=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H38O2Si/c1-15(2)17-11-10-16(3)14-19(17,20)12-9-13-21-22(7,8)18(4,5)6/h9,12,15-17,20H,10-11,13-14H2,1-8H3/b12-9+/t16-,17+,19+/m1/s1 |
| InChIKey | RUDPGYCCOZWXIG-XULLOUEZSA-N |
| XLogP | 5.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|