C26H46O3Si — CID 134946551
(2R,3E,7E,10S,13S)-2-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyl-13-prop-1-en-2-ylbicyclo[8.2.2]tetradeca-3,7-diene-11,12-diol (PubChem CID 134946551) has the molecular formula C26H46O3Si and a molecular weight of 434.74 g/mol. Its IUPAC name is (2R,3E,7E,10S,13S)-2-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyl-13-prop-1-en-2-ylbicyclo[8.2.2]tetradeca-3,7-diene-11,12-diol.
| Compound Name | (2R,3E,7E,10S,13S)-2-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyl-13-prop-1-en-2-ylbicyclo[8.2.2]tetradeca-3,7-diene-11,12-diol |
|---|---|
| PubChem CID | 134946551 |
| Molecular Formula | C26H46O3Si |
| Molecular Weight | 434.74 g/mol |
| Exact Mass | 434.32 |
| IUPAC Name | (2R,3E,7E,10S,13S)-2-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyl-13-prop-1-en-2-ylbicyclo[8.2.2]tetradeca-3,7-diene-11,12-diol |
| SMILES | C=C(C)C1C[C@@H]2C/C=C(/C)CC/C=C(/C)[C@H](O[Si](C)(C)C(C)(C)C)C1C(O)C2(C)O |
| InChI | InChI=1S/C26H46O3Si/c1-17(2)21-16-20-15-14-18(3)12-11-13-19(4)23(22(21)24(27)26(20,8)28)29-30(9,10)25(5,6)7/h13-14,20-24,27-28H,1,11-12,15-16H2,2-10H3/b18-14-,19-13-/t20-,21?,22?,23-,24?,26?/m0/s1 |
| InChIKey | RZTNEQCJRIGYNS-XBRGCJPFSA-N |
| XLogP | 6.39 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.74 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|