C25H46O2Si — CID 11338727
[(4aR,5S,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-5,8a-dimethyl-5-(4-methylpent-3-enyl)-3,4,4a,6,7,8-hexahydronaphthalen-2-yl]methanol (PubChem CID 11338727) has the molecular formula C25H46O2Si and a molecular weight of 406.73 g/mol. Its IUPAC name is [(4aR,5S,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-5,8a-dimethyl-5-(4-methylpent-3-enyl)-3,4,4a,6,7,8-hexahydronaphthalen-2-yl]methanol.
| Compound Name | [(4aR,5S,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-5,8a-dimethyl-5-(4-methylpent-3-enyl)-3,4,4a,6,7,8-hexahydronaphthalen-2-yl]methanol |
|---|---|
| PubChem CID | 11338727 |
| Molecular Formula | C25H46O2Si |
| Molecular Weight | 406.73 g/mol |
| Exact Mass | 406.33 |
| IUPAC Name | [(4aR,5S,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-5,8a-dimethyl-5-(4-methylpent-3-enyl)-3,4,4a,6,7,8-hexahydronaphthalen-2-yl]methanol |
| SMILES | CC(C)=CCC[C@]1(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]2(C)C=C(CO)CC[C@@H]12 |
| InChI | InChI=1S/C25H46O2Si/c1-19(2)11-10-15-25(7)21-13-12-20(18-26)17-24(21,6)16-14-22(25)27-28(8,9)23(3,4)5/h11,17,21-22,26H,10,12-16,18H2,1-9H3/t21-,22+,24-,25+/m1/s1 |
| InChIKey | UULUCAQPOHHRGH-OUMDNPPYSA-N |
| XLogP | 7.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.73 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|