C22H46O3Si2 — CID 10525891
(1S,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-1-[(E)-3-trimethylsilyloxybut-1-enyl]cyclohexan-1-ol (PubChem CID 10525891) has the molecular formula C22H46O3Si2 and a molecular weight of 414.78 g/mol. Its IUPAC name is (1S,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-1-[(E)-3-trimethylsilyloxybut-1-enyl]cyclohexan-1-ol.
| Compound Name | (1S,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-1-[(E)-3-trimethylsilyloxybut-1-enyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 10525891 |
| Molecular Formula | C22H46O3Si2 |
| Molecular Weight | 414.78 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | (1S,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-1-[(E)-3-trimethylsilyloxybut-1-enyl]cyclohexan-1-ol |
| SMILES | CC(/C=C/[C@@]1(O)[C@@H](C)C[C@@H](O[Si](C)(C)C(C)(C)C)CC1(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C22H46O3Si2/c1-17-15-19(25-27(11,12)20(3,4)5)16-21(6,7)22(17,23)14-13-18(2)24-26(8,9)10/h13-14,17-19,23H,15-16H2,1-12H3/b14-13+/t17-,18?,19+,22+/m0/s1 |
| InChIKey | HUWBQEJIBLIEQN-NZQGODDTSA-N |
| XLogP | 6.36 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.78 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|