C19H36O3Si — CID 10664907
(E)-4-[(1S,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-2,2,6-trimethylcyclohexyl]but-3-en-2-one (PubChem CID 10664907) has the molecular formula C19H36O3Si and a molecular weight of 340.58 g/mol. Its IUPAC name is (E)-4-[(1S,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-2,2,6-trimethylcyclohexyl]but-3-en-2-one.
| Compound Name | (E)-4-[(1S,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-2,2,6-trimethylcyclohexyl]but-3-en-2-one |
|---|---|
| PubChem CID | 10664907 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | (E)-4-[(1S,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-2,2,6-trimethylcyclohexyl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/[C@@]1(O)[C@H](C)C[C@H](O[Si](C)(C)C(C)(C)C)CC1(C)C |
| InChI | InChI=1S/C19H36O3Si/c1-14-12-16(22-23(8,9)17(3,4)5)13-18(6,7)19(14,21)11-10-15(2)20/h10-11,14,16,21H,12-13H2,1-9H3/b11-10+/t14-,16+,19-/m1/s1 |
| InChIKey | XBALRBJVWCVOMA-AGLBRUNXSA-N |
| XLogP | 4.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|