C21H22FN5O3 — CID 66575906
methyl N-[[3-(ethylcarbamoylamino)-5-(2-fluoro-5-methyl-4-pyridinyl)isoquinolin-8-yl]methyl]carbamate (PubChem CID 66575906) has the molecular formula C21H22FN5O3 and a molecular weight of 411.44 g/mol. Its IUPAC name is methyl N-[[3-(ethylcarbamoylamino)-5-(2-fluoro-5-methyl-4-pyridinyl)isoquinolin-8-yl]methyl]carbamate.
| Compound Name | methyl N-[[3-(ethylcarbamoylamino)-5-(2-fluoro-5-methyl-4-pyridinyl)isoquinolin-8-yl]methyl]carbamate |
|---|---|
| PubChem CID | 66575906 |
| Molecular Formula | C21H22FN5O3 |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | methyl N-[[3-(ethylcarbamoylamino)-5-(2-fluoro-5-methyl-4-pyridinyl)isoquinolin-8-yl]methyl]carbamate |
| SMILES | CCNC(=O)Nc1cc2c(-c3cc(F)ncc3C)ccc(CNC(=O)OC)c2cn1 |
| InChI | InChI=1S/C21H22FN5O3/c1-4-23-20(28)27-19-8-16-14(15-7-18(22)24-9-12(15)2)6-5-13(17(16)11-25-19)10-26-21(29)30-3/h5-9,11H,4,10H2,1-3H3,(H,26,29)(H2,23,25,27,28) |
| InChIKey | ISUNNOFKSZALFH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|