C33H33NO3 — CID 66578299
ethyl 2-[1-[4-[4-[3-methyl-4-(4-phenylbut-2-enyl)-1,2-oxazol-5-yl]phenyl]phenyl]cyclopropyl]acetate (PubChem CID 66578299) has the molecular formula C33H33NO3 and a molecular weight of 491.63 g/mol. Its IUPAC name is ethyl 2-[1-[4-[4-[3-methyl-4-(4-phenylbut-2-enyl)-1,2-oxazol-5-yl]phenyl]phenyl]cyclopropyl]acetate.
| Compound Name | ethyl 2-[1-[4-[4-[3-methyl-4-(4-phenylbut-2-enyl)-1,2-oxazol-5-yl]phenyl]phenyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 66578299 |
| Molecular Formula | C33H33NO3 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | ethyl 2-[1-[4-[4-[3-methyl-4-(4-phenylbut-2-enyl)-1,2-oxazol-5-yl]phenyl]phenyl]cyclopropyl]acetate |
| SMILES | CCOC(=O)CC1(c2ccc(-c3ccc(-c4onc(C)c4CC=CCc4ccccc4)cc3)cc2)CC1 |
| InChI | InChI=1S/C33H33NO3/c1-3-36-31(35)23-33(21-22-33)29-19-17-27(18-20-29)26-13-15-28(16-14-26)32-30(24(2)34-37-32)12-8-7-11-25-9-5-4-6-10-25/h4-10,13-20H,3,11-12,21-23H2,1-2H3 |
| InChIKey | NBCMEFRAQIIISJ-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|