C18H24N6O — CID 66581453
6-(2-aminoethyl)-3-[4-[(3-aminopropylamino)methyl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-one (PubChem CID 66581453) has the molecular formula C18H24N6O and a molecular weight of 340.43 g/mol. Its IUPAC name is 6-(2-aminoethyl)-3-[4-[(3-aminopropylamino)methyl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-one.
| Compound Name | 6-(2-aminoethyl)-3-[4-[(3-aminopropylamino)methyl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 66581453 |
| Molecular Formula | C18H24N6O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 6-(2-aminoethyl)-3-[4-[(3-aminopropylamino)methyl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-one |
| SMILES | NCCCNCc1ccc(-n2cc3cc(CCN)[nH]c3nc2=O)cc1 |
| InChI | InChI=1S/C18H24N6O/c19-7-1-9-21-11-13-2-4-16(5-3-13)24-12-14-10-15(6-8-20)22-17(14)23-18(24)25/h2-5,10,12,21H,1,6-9,11,19-20H2,(H,22,23,25) |
| InChIKey | DIXSASURLYKBAZ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 114.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|