About 7-azaspiro[2.7]decane
7-azaspiro[2.7]decane (PubChem CID 66586168) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is 7-azaspiro[2.7]decane.
Molecular Properties
| Compound Name | 7-azaspiro[2.7]decane |
| PubChem CID | 66586168 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | 7-azaspiro[2.7]decane |
| SMILES | C1CNCCCC2(C1)CC2 |
| InChI | InChI=1S/C9H17N/c1-3-9(5-6-9)4-2-8-10-7-1/h10H,1-8H2 |
| InChIKey | LYVQWFMPQFBXJU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-azaspiro[2.7]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-azaspiro[2.7]decane?
The IUPAC name of 7-azaspiro[2.7]decane (CID 66586168) is 7-azaspiro[2.7]decane.
What is the SMILES notation for 7-azaspiro[2.7]decane?
The canonical SMILES for 7-azaspiro[2.7]decane is C1CNCCCC2(C1)CC2.
What is the InChIKey of 7-azaspiro[2.7]decane?
The InChIKey is LYVQWFMPQFBXJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N/c1-3-9(5-6-9)4-2-8-10-7-1/h10H,1-8H2.
What are the key properties of 7-azaspiro[2.7]decane?
7-azaspiro[2.7]decane has a molecular weight of 139.24 g/mol, XLogP of 1.93, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-azaspiro[2.7]decane is sourced from PubChem (CID 66586168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).