C36H39N3O4S — CID 66588109
3-[[3-[[2-[4-(1-hydroxy-3-phenylpropyl)-2-pyridinyl]-4-piperidin-1-ylphenyl]carbamoyl]phenyl]methylsulfanyl]propanoic acid (PubChem CID 66588109) has the molecular formula C36H39N3O4S and a molecular weight of 609.79 g/mol. Its IUPAC name is 3-[[3-[[2-[4-(1-hydroxy-3-phenylpropyl)-2-pyridinyl]-4-piperidin-1-ylphenyl]carbamoyl]phenyl]methylsulfanyl]propanoic acid.
| Compound Name | 3-[[3-[[2-[4-(1-hydroxy-3-phenylpropyl)-2-pyridinyl]-4-piperidin-1-ylphenyl]carbamoyl]phenyl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 66588109 |
| Molecular Formula | C36H39N3O4S |
| Molecular Weight | 609.79 g/mol |
| Exact Mass | 609.27 |
| IUPAC Name | 3-[[3-[[2-[4-(1-hydroxy-3-phenylpropyl)-2-pyridinyl]-4-piperidin-1-ylphenyl]carbamoyl]phenyl]methylsulfanyl]propanoic acid |
| SMILES | O=C(O)CCSCc1cccc(C(=O)Nc2ccc(N3CCCCC3)cc2-c2cc(C(O)CCc3ccccc3)ccn2)c1 |
| InChI | InChI=1S/C36H39N3O4S/c40-34(15-12-26-8-3-1-4-9-26)28-16-18-37-33(23-28)31-24-30(39-19-5-2-6-20-39)13-14-32(31)38-36(43)29-11-7-10-27(22-29)25-44-21-17-35(41)42/h1,3-4,7-11,13-14,16,18,22-24,34,40H,2,5-6,12,15,17,19-21,25H2,(H,38,43)(H,41,42) |
| InChIKey | IRANAKNGMVYLFU-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.79 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|