C29H39N3O8 — CID 66588268
3-[1-[[(E)-3-(4,5-dimethoxy-2-nitrophenyl)prop-2-enoyl]amino]-2-methylbutan-2-yl]oxy-N-[2-(4-hydroxyphenyl)ethyl]-2,2-dimethylpropanamide (PubChem CID 66588268) has the molecular formula C29H39N3O8 and a molecular weight of 557.64 g/mol. Its IUPAC name is 3-[1-[[(E)-3-(4,5-dimethoxy-2-nitrophenyl)prop-2-enoyl]amino]-2-methylbutan-2-yl]oxy-N-[2-(4-hydroxyphenyl)ethyl]-2,2-dimethylpropanamide.
| Compound Name | 3-[1-[[(E)-3-(4,5-dimethoxy-2-nitrophenyl)prop-2-enoyl]amino]-2-methylbutan-2-yl]oxy-N-[2-(4-hydroxyphenyl)ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 66588268 |
| Molecular Formula | C29H39N3O8 |
| Molecular Weight | 557.64 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | 3-[1-[[(E)-3-(4,5-dimethoxy-2-nitrophenyl)prop-2-enoyl]amino]-2-methylbutan-2-yl]oxy-N-[2-(4-hydroxyphenyl)ethyl]-2,2-dimethylpropanamide |
| SMILES | CCC(C)(CNC(=O)/C=C/c1cc(OC)c(OC)cc1[N+](=O)[O-])OCC(C)(C)C(=O)NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C29H39N3O8/c1-7-29(4,40-19-28(2,3)27(35)30-15-14-20-8-11-22(33)12-9-20)18-31-26(34)13-10-21-16-24(38-5)25(39-6)17-23(21)32(36)37/h8-13,16-17,33H,7,14-15,18-19H2,1-6H3,(H,30,35)(H,31,34)/b13-10+ |
| InChIKey | OLYMJGZHBKTCSY-JLHYYAGUSA-N |
| XLogP | 4.02 |
| TPSA | 149.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.64 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|