C8H18ClNO — CID 66589139
trans-(1R,2R)-2-ethoxycyclohexan-1-amine;hydrochloride (PubChem CID 66589139) has the molecular formula C8H18ClNO and a molecular weight of 179.69 g/mol. Its IUPAC name is trans-(1R,2R)-2-ethoxycyclohexan-1-amine;hydrochloride.
| Compound Name | trans-(1R,2R)-2-ethoxycyclohexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 66589139 |
| Molecular Formula | C8H18ClNO |
| Molecular Weight | 179.69 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | trans-(1R,2R)-2-ethoxycyclohexan-1-amine;hydrochloride |
| SMILES | CCO[C@@H]1CCCC[C@H]1N.Cl |
| InChI | InChI=1S/C8H17NO.ClH/c1-2-10-8-6-4-3-5-7(8)9;/h7-8H,2-6,9H2,1H3;1H/t7-,8-;/m1./s1 |
| InChIKey | RTFJRBOHHFQHHC-SCLLHFNJSA-N |
| XLogP | 1.71 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.69 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |