C18H27NO3 — CID 66589228
(E,2S)-N-[(4-hydroxy-3-methoxyphenyl)methyl]-2-methylnon-6-enamide (PubChem CID 66589228) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is (E,2S)-N-[(4-hydroxy-3-methoxyphenyl)methyl]-2-methylnon-6-enamide.
| Compound Name | (E,2S)-N-[(4-hydroxy-3-methoxyphenyl)methyl]-2-methylnon-6-enamide |
|---|---|
| PubChem CID | 66589228 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | (E,2S)-N-[(4-hydroxy-3-methoxyphenyl)methyl]-2-methylnon-6-enamide |
| SMILES | CC/C=C/CCC[C@H](C)C(=O)NCc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C18H27NO3/c1-4-5-6-7-8-9-14(2)18(21)19-13-15-10-11-16(20)17(12-15)22-3/h5-6,10-12,14,20H,4,7-9,13H2,1-3H3,(H,19,21)/b6-5+/t14-/m0/s1 |
| InChIKey | RVWDXTIDSURKKB-GJBLVYBDSA-N |
| XLogP | 3.79 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|