C20H21N3O3 — CID 66589783
4-(hydroxymethyl)-N-[5-[2-(3-methoxyphenyl)ethyl]-1H-pyrazol-3-yl]benzamide (PubChem CID 66589783) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 4-(hydroxymethyl)-N-[5-[2-(3-methoxyphenyl)ethyl]-1H-pyrazol-3-yl]benzamide.
| Compound Name | 4-(hydroxymethyl)-N-[5-[2-(3-methoxyphenyl)ethyl]-1H-pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 66589783 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 4-(hydroxymethyl)-N-[5-[2-(3-methoxyphenyl)ethyl]-1H-pyrazol-3-yl]benzamide |
| SMILES | COc1cccc(CCc2cc(NC(=O)c3ccc(CO)cc3)n[nH]2)c1 |
| InChI | InChI=1S/C20H21N3O3/c1-26-18-4-2-3-14(11-18)7-10-17-12-19(23-22-17)21-20(25)16-8-5-15(13-24)6-9-16/h2-6,8-9,11-12,24H,7,10,13H2,1H3,(H2,21,22,23,25) |
| InChIKey | DPRSWOBINUHRTN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |