C20H22N4O4S — CID 66589647
4-(methanesulfonamido)-N-[5-[2-(3-methoxyphenyl)ethyl]-1H-pyrazol-3-yl]benzamide (PubChem CID 66589647) has the molecular formula C20H22N4O4S and a molecular weight of 414.49 g/mol. Its IUPAC name is 4-(methanesulfonamido)-N-[5-[2-(3-methoxyphenyl)ethyl]-1H-pyrazol-3-yl]benzamide.
| Compound Name | 4-(methanesulfonamido)-N-[5-[2-(3-methoxyphenyl)ethyl]-1H-pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 66589647 |
| Molecular Formula | C20H22N4O4S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 4-(methanesulfonamido)-N-[5-[2-(3-methoxyphenyl)ethyl]-1H-pyrazol-3-yl]benzamide |
| SMILES | COc1cccc(CCc2cc(NC(=O)c3ccc(NS(C)(=O)=O)cc3)n[nH]2)c1 |
| InChI | InChI=1S/C20H22N4O4S/c1-28-18-5-3-4-14(12-18)6-9-17-13-19(23-22-17)21-20(25)15-7-10-16(11-8-15)24-29(2,26)27/h3-5,7-8,10-13,24H,6,9H2,1-2H3,(H2,21,22,23,25) |
| InChIKey | MMYHYVFABXWZGF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |