C20H22N4O4S — CID 90778691
N-[5-[2-(3-methoxyphenyl)ethyl]-1H-pyrazol-3-yl]-N'-methylsulfonylbenzohydrazide (PubChem CID 90778691) has the molecular formula C20H22N4O4S and a molecular weight of 414.49 g/mol. Its IUPAC name is N-[5-[2-(3-methoxyphenyl)ethyl]-1H-pyrazol-3-yl]-N'-methylsulfonylbenzohydrazide.
| Compound Name | N-[5-[2-(3-methoxyphenyl)ethyl]-1H-pyrazol-3-yl]-N'-methylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 90778691 |
| Molecular Formula | C20H22N4O4S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | N-[5-[2-(3-methoxyphenyl)ethyl]-1H-pyrazol-3-yl]-N'-methylsulfonylbenzohydrazide |
| SMILES | COc1cccc(CCc2cc(N(NS(C)(=O)=O)C(=O)c3ccccc3)n[nH]2)c1 |
| InChI | InChI=1S/C20H22N4O4S/c1-28-18-10-6-7-15(13-18)11-12-17-14-19(22-21-17)24(23-29(2,26)27)20(25)16-8-4-3-5-9-16/h3-10,13-14,23H,11-12H2,1-2H3,(H,21,22) |
| InChIKey | QTMVZRILECWZCQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|