C22H37NO8 — CID 66592008
ethyl 4-[[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]oxycarbonyloxy-pyrrolidin-1-ylmethoxy]cyclohexane-1-carboxylate (PubChem CID 66592008) has the molecular formula C22H37NO8 and a molecular weight of 443.54 g/mol. Its IUPAC name is ethyl 4-[[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]oxycarbonyloxy-pyrrolidin-1-ylmethoxy]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]oxycarbonyloxy-pyrrolidin-1-ylmethoxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 66592008 |
| Molecular Formula | C22H37NO8 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | ethyl 4-[[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]oxycarbonyloxy-pyrrolidin-1-ylmethoxy]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(OC(OC(=O)OC(C)C(=O)OC(C)(C)C)N2CCCC2)CC1 |
| InChI | InChI=1S/C22H37NO8/c1-6-27-19(25)16-9-11-17(12-10-16)29-20(23-13-7-8-14-23)30-21(26)28-15(2)18(24)31-22(3,4)5/h15-17,20H,6-14H2,1-5H3 |
| InChIKey | SJFPWCKOGACZRJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|