C22H37NO6 — CID 139988654
ethyl 4-[(S)-[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxobut-3-en-2-yl]oxy-pyrrolidin-1-ylmethoxy]cyclohexane-1-carboxylate (PubChem CID 139988654) has the molecular formula C22H37NO6 and a molecular weight of 411.54 g/mol. Its IUPAC name is ethyl 4-[(S)-[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxobut-3-en-2-yl]oxy-pyrrolidin-1-ylmethoxy]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[(S)-[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxobut-3-en-2-yl]oxy-pyrrolidin-1-ylmethoxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139988654 |
| Molecular Formula | C22H37NO6 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | ethyl 4-[(S)-[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxobut-3-en-2-yl]oxy-pyrrolidin-1-ylmethoxy]cyclohexane-1-carboxylate |
| SMILES | C=C[C@H](O[C@H](OC1CCC(C(=O)OCC)CC1)N1CCCC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H37NO6/c1-6-18(20(25)29-22(3,4)5)28-21(23-14-8-9-15-23)27-17-12-10-16(11-13-17)19(24)26-7-2/h6,16-18,21H,1,7-15H2,2-5H3/t16?,17?,18-,21-/m0/s1 |
| InChIKey | YDVRMSLPCYOQMC-XVAHUTHZSA-N |
| XLogP | 3.42 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|