C20H20N4O3 — CID 66595076
2-(7,9-dimethoxy-8-methyl-3,6-dihydro-2H-imidazo[1,2-c]quinazolin-5-ylidene)-1-pyridin-3-ylethanone (PubChem CID 66595076) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 2-(7,9-dimethoxy-8-methyl-3,6-dihydro-2H-imidazo[1,2-c]quinazolin-5-ylidene)-1-pyridin-3-ylethanone.
| Compound Name | 2-(7,9-dimethoxy-8-methyl-3,6-dihydro-2H-imidazo[1,2-c]quinazolin-5-ylidene)-1-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 66595076 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-(7,9-dimethoxy-8-methyl-3,6-dihydro-2H-imidazo[1,2-c]quinazolin-5-ylidene)-1-pyridin-3-ylethanone |
| SMILES | COc1cc2c(c(OC)c1C)NC(=CC(=O)c1cccnc1)N1CCN=C21 |
| InChI | InChI=1S/C20H20N4O3/c1-12-16(26-2)9-14-18(19(12)27-3)23-17(24-8-7-22-20(14)24)10-15(25)13-5-4-6-21-11-13/h4-6,9-11,23H,7-8H2,1-3H3 |
| InChIKey | OGQMEHBIMJSQSQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 76.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|