C16H13N5O — CID 66595108
1-pyridin-3-yl-2-(3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraen-7-ylidene)ethanone (PubChem CID 66595108) has the molecular formula C16H13N5O and a molecular weight of 291.31 g/mol. Its IUPAC name is 1-pyridin-3-yl-2-(3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraen-7-ylidene)ethanone.
| Compound Name | 1-pyridin-3-yl-2-(3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraen-7-ylidene)ethanone |
|---|---|
| PubChem CID | 66595108 |
| Molecular Formula | C16H13N5O |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1-pyridin-3-yl-2-(3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraen-7-ylidene)ethanone |
| SMILES | O=C(C=C1Nc2ccncc2C2=NCCN12)c1cccnc1 |
| InChI | InChI=1S/C16H13N5O/c22-14(11-2-1-4-17-9-11)8-15-20-13-3-5-18-10-12(13)16-19-6-7-21(15)16/h1-5,8-10,20H,6-7H2 |
| InChIKey | OIGCBPAXGYIHAF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|