C13H17IO3 — CID 66596121
[2-iodo-1-(methoxymethyl)-2-bicyclo[2.2.1]hept-5-enyl] 2-methylprop-2-enoate (PubChem CID 66596121) has the molecular formula C13H17IO3 and a molecular weight of 348.18 g/mol. Its IUPAC name is [2-iodo-1-(methoxymethyl)-2-bicyclo[2.2.1]hept-5-enyl] 2-methylprop-2-enoate.
| Compound Name | [2-iodo-1-(methoxymethyl)-2-bicyclo[2.2.1]hept-5-enyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 66596121 |
| Molecular Formula | C13H17IO3 |
| Molecular Weight | 348.18 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | [2-iodo-1-(methoxymethyl)-2-bicyclo[2.2.1]hept-5-enyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(I)CC2C=CC1(COC)C2 |
| InChI | InChI=1S/C13H17IO3/c1-9(2)11(15)17-13(14)7-10-4-5-12(13,6-10)8-16-3/h4-5,10H,1,6-8H2,2-3H3 |
| InChIKey | VBYGETWDTOIIRQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.18 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|