C15H25IO2 — CID 88975949
[4-(iodomethyl)-1,2,2,3,3-pentamethylcyclopentyl] 2-methylprop-2-enoate (PubChem CID 88975949) has the molecular formula C15H25IO2 and a molecular weight of 364.27 g/mol. Its IUPAC name is [4-(iodomethyl)-1,2,2,3,3-pentamethylcyclopentyl] 2-methylprop-2-enoate.
| Compound Name | [4-(iodomethyl)-1,2,2,3,3-pentamethylcyclopentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88975949 |
| Molecular Formula | C15H25IO2 |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | [4-(iodomethyl)-1,2,2,3,3-pentamethylcyclopentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(C)CC(CI)C(C)(C)C1(C)C |
| InChI | InChI=1S/C15H25IO2/c1-10(2)12(17)18-15(7)8-11(9-16)13(3,4)14(15,5)6/h11H,1,8-9H2,2-7H3 |
| InChIKey | MJJIVDXODOAEIA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|