C31H36N2O4 — CID 66597128
benzyl 5-[3-[(1-methylpiperidin-4-yl)oxycarbonylamino]-4-phenylphenyl]pentanoate (PubChem CID 66597128) has the molecular formula C31H36N2O4 and a molecular weight of 500.64 g/mol. Its IUPAC name is benzyl 5-[3-[(1-methylpiperidin-4-yl)oxycarbonylamino]-4-phenylphenyl]pentanoate.
| Compound Name | benzyl 5-[3-[(1-methylpiperidin-4-yl)oxycarbonylamino]-4-phenylphenyl]pentanoate |
|---|---|
| PubChem CID | 66597128 |
| Molecular Formula | C31H36N2O4 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | benzyl 5-[3-[(1-methylpiperidin-4-yl)oxycarbonylamino]-4-phenylphenyl]pentanoate |
| SMILES | CN1CCC(OC(=O)Nc2cc(CCCCC(=O)OCc3ccccc3)ccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C31H36N2O4/c1-33-20-18-27(19-21-33)37-31(35)32-29-22-24(16-17-28(29)26-13-6-3-7-14-26)10-8-9-15-30(34)36-23-25-11-4-2-5-12-25/h2-7,11-14,16-17,22,27H,8-10,15,18-21,23H2,1H3,(H,32,35) |
| InChIKey | AQRMGUVXGXADOV-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|