C26H32N2O4 — CID 77227698
tert-butyl 3-[3-[(1-methylpiperidin-4-yl)oxycarbonylamino]-4-phenylphenyl]prop-2-enoate (PubChem CID 77227698) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is tert-butyl 3-[3-[(1-methylpiperidin-4-yl)oxycarbonylamino]-4-phenylphenyl]prop-2-enoate.
| Compound Name | tert-butyl 3-[3-[(1-methylpiperidin-4-yl)oxycarbonylamino]-4-phenylphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 77227698 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | tert-butyl 3-[3-[(1-methylpiperidin-4-yl)oxycarbonylamino]-4-phenylphenyl]prop-2-enoate |
| SMILES | CN1CCC(OC(=O)Nc2cc(C=CC(=O)OC(C)(C)C)ccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C26H32N2O4/c1-26(2,3)32-24(29)13-11-19-10-12-22(20-8-6-5-7-9-20)23(18-19)27-25(30)31-21-14-16-28(4)17-15-21/h5-13,18,21H,14-17H2,1-4H3,(H,27,30) |
| InChIKey | FVYOFPVAFCOTGK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|