C19H17N3O3 — CID 66600490
[3-(isoquinolin-5-ylamino)-3-oxo-2-phenylpropyl]carbamic acid (PubChem CID 66600490) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is [3-(isoquinolin-5-ylamino)-3-oxo-2-phenylpropyl]carbamic acid.
| Compound Name | [3-(isoquinolin-5-ylamino)-3-oxo-2-phenylpropyl]carbamic acid |
|---|---|
| PubChem CID | 66600490 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | [3-(isoquinolin-5-ylamino)-3-oxo-2-phenylpropyl]carbamic acid |
| SMILES | O=C(O)NCC(C(=O)Nc1cccc2cnccc12)c1ccccc1 |
| InChI | InChI=1S/C19H17N3O3/c23-18(16(12-21-19(24)25)13-5-2-1-3-6-13)22-17-8-4-7-14-11-20-10-9-15(14)17/h1-11,16,21H,12H2,(H,22,23)(H,24,25) |
| InChIKey | WXKSBLLGPHIKQH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |