C17H34N2 — CID 66600663
1-tert-butyl-4-(3-tert-butylpyrrolidin-1-yl)piperidine (PubChem CID 66600663) has the molecular formula C17H34N2 and a molecular weight of 266.47 g/mol. Its IUPAC name is 1-tert-butyl-4-(3-tert-butylpyrrolidin-1-yl)piperidine.
| Compound Name | 1-tert-butyl-4-(3-tert-butylpyrrolidin-1-yl)piperidine |
|---|---|
| PubChem CID | 66600663 |
| Molecular Formula | C17H34N2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.27 |
| IUPAC Name | 1-tert-butyl-4-(3-tert-butylpyrrolidin-1-yl)piperidine |
| SMILES | CC(C)(C)C1CCN(C2CCN(C(C)(C)C)CC2)C1 |
| InChI | InChI=1S/C17H34N2/c1-16(2,3)14-7-10-18(13-14)15-8-11-19(12-9-15)17(4,5)6/h14-15H,7-13H2,1-6H3 |
| InChIKey | QABXGEPOABXWLT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |