C17H36N2 — CID 18727338
N-ethyl-N,1,2,2,3,4,5,5-octamethyl-4-propan-2-ylpyrrolidin-3-amine (PubChem CID 18727338) has the molecular formula C17H36N2 and a molecular weight of 268.49 g/mol. Its IUPAC name is N-ethyl-N,1,2,2,3,4,5,5-octamethyl-4-propan-2-ylpyrrolidin-3-amine.
| Compound Name | N-ethyl-N,1,2,2,3,4,5,5-octamethyl-4-propan-2-ylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 18727338 |
| Molecular Formula | C17H36N2 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.29 |
| IUPAC Name | N-ethyl-N,1,2,2,3,4,5,5-octamethyl-4-propan-2-ylpyrrolidin-3-amine |
| SMILES | CCN(C)C1(C)C(C)(C)N(C)C(C)(C)C1(C)C(C)C |
| InChI | InChI=1S/C17H36N2/c1-12-18(10)17(9)15(6,7)19(11)14(4,5)16(17,8)13(2)3/h13H,12H2,1-11H3 |
| InChIKey | KTRIXNSVCOCZPE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |