C12H26N2 — CID 54423659
1-ethyl-2,2,3,4,5,5-hexamethylpyrrolidin-3-amine (PubChem CID 54423659) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is 1-ethyl-2,2,3,4,5,5-hexamethylpyrrolidin-3-amine.
| Compound Name | 1-ethyl-2,2,3,4,5,5-hexamethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 54423659 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | 1-ethyl-2,2,3,4,5,5-hexamethylpyrrolidin-3-amine |
| SMILES | CCN1C(C)(C)C(C)C(C)(N)C1(C)C |
| InChI | InChI=1S/C12H26N2/c1-8-14-10(3,4)9(2)12(7,13)11(14,5)6/h9H,8,13H2,1-7H3 |
| InChIKey | WCOFFIJKTMMOBT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |