About cis-(1S,3R)-N,N-dimethyl-3-(4-propan-2-ylpiperazin-1-yl)cyclohexan-1-amine
cis-(1S,3R)-N,N-dimethyl-3-(4-propan-2-ylpiperazin-1-yl)cyclohexan-1-amine (PubChem CID 66602973) has the molecular formula C15H31N3
and a molecular weight of 253.43 g/mol. Its IUPAC name is cis-(1S,3R)-N,N-dimethyl-3-(4-propan-2-ylpiperazin-1-yl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | cis-(1S,3R)-N,N-dimethyl-3-(4-propan-2-ylpiperazin-1-yl)cyclohexan-1-amine |
| PubChem CID | 66602973 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | cis-(1S,3R)-N,N-dimethyl-3-(4-propan-2-ylpiperazin-1-yl)cyclohexan-1-amine |
| SMILES | CC(C)N1CCN([C@@H]2CCC[C@H](N(C)C)C2)CC1 |
| InChI | InChI=1S/C15H31N3/c1-13(2)17-8-10-18(11-9-17)15-7-5-6-14(12-15)16(3)4/h13-15H,5-12H2,1-4H3/t14-,15+/m0/s1 |
| InChIKey | ZOAZUOLKMHNPPI-LSDHHAIUSA-N |
| XLogP | 1.89 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cis-(1S,3R)-N,N-dimethyl-3-(4-propan-2-ylpiperazin-1-yl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,3R)-N,N-dimethyl-3-(4-propan-2-ylpiperazin-1-yl)cyclohexan-1-amine?
The IUPAC name of cis-(1S,3R)-N,N-dimethyl-3-(4-propan-2-ylpiperazin-1-yl)cyclohexan-1-amine (CID 66602973) is cis-(1S,3R)-N,N-dimethyl-3-(4-propan-2-ylpiperazin-1-yl)cyclohexan-1-amine.
What is the SMILES notation for cis-(1S,3R)-N,N-dimethyl-3-(4-propan-2-ylpiperazin-1-yl)cyclohexan-1-amine?
The canonical SMILES for cis-(1S,3R)-N,N-dimethyl-3-(4-propan-2-ylpiperazin-1-yl)cyclohexan-1-amine is CC(C)N1CCN([C@@H]2CCC[C@H](N(C)C)C2)CC1.
What is the InChIKey of cis-(1S,3R)-N,N-dimethyl-3-(4-propan-2-ylpiperazin-1-yl)cyclohexan-1-amine?
The InChIKey is ZOAZUOLKMHNPPI-LSDHHAIUSA-N. The full InChI is InChI=1S/C15H31N3/c1-13(2)17-8-10-18(11-9-17)15-7-5-6-14(12-15)16(3)4/h13-15H,5-12H2,1-4H3/t14-,15+/m0/s1.
What are the key properties of cis-(1S,3R)-N,N-dimethyl-3-(4-propan-2-ylpiperazin-1-yl)cyclohexan-1-amine?
cis-(1S,3R)-N,N-dimethyl-3-(4-propan-2-ylpiperazin-1-yl)cyclohexan-1-amine has a molecular weight of 253.43 g/mol, XLogP of 1.89, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,3R)-N,N-dimethyl-3-(4-propan-2-ylpiperazin-1-yl)cyclohexan-1-amine is sourced from PubChem (CID 66602973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).