About 2-(3-chlorophenyl)-7-(morpholin-4-ylmethyl)-5H-pyrido[3,2-b]indole-4-carboxamide
2-(3-chlorophenyl)-7-(morpholin-4-ylmethyl)-5H-pyrido[3,2-b]indole-4-carboxamide (PubChem CID 66604426) has the molecular formula C23H21ClN4O2
and a molecular weight of 420.90 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-7-(morpholin-4-ylmethyl)-5H-pyrido[3,2-b]indole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(3-chlorophenyl)-7-(morpholin-4-ylmethyl)-5H-pyrido[3,2-b]indole-4-carboxamide |
| PubChem CID | 66604426 |
| Molecular Formula | C23H21ClN4O2 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2-(3-chlorophenyl)-7-(morpholin-4-ylmethyl)-5H-pyrido[3,2-b]indole-4-carboxamide |
| SMILES | NC(=O)c1cc(-c2cccc(Cl)c2)nc2c1[nH]c1cc(CN3CCOCC3)ccc12 |
| InChI | InChI=1S/C23H21ClN4O2/c24-16-3-1-2-15(11-16)19-12-18(23(25)29)22-21(26-19)17-5-4-14(10-20(17)27-22)13-28-6-8-30-9-7-28/h1-5,10-12,27H,6-9,13H2,(H2,25,29) |
| InChIKey | QAUBZVPXJJHKCL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-chlorophenyl)-7-(morpholin-4-ylmethyl)-5H-pyrido[3,2-b]indole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenyl)-7-(morpholin-4-ylmethyl)-5H-pyrido[3,2-b]indole-4-carboxamide?
The IUPAC name of 2-(3-chlorophenyl)-7-(morpholin-4-ylmethyl)-5H-pyrido[3,2-b]indole-4-carboxamide (CID 66604426) is 2-(3-chlorophenyl)-7-(morpholin-4-ylmethyl)-5H-pyrido[3,2-b]indole-4-carboxamide.
What is the SMILES notation for 2-(3-chlorophenyl)-7-(morpholin-4-ylmethyl)-5H-pyrido[3,2-b]indole-4-carboxamide?
The canonical SMILES for 2-(3-chlorophenyl)-7-(morpholin-4-ylmethyl)-5H-pyrido[3,2-b]indole-4-carboxamide is NC(=O)c1cc(-c2cccc(Cl)c2)nc2c1[nH]c1cc(CN3CCOCC3)ccc12.
What is the InChIKey of 2-(3-chlorophenyl)-7-(morpholin-4-ylmethyl)-5H-pyrido[3,2-b]indole-4-carboxamide?
The InChIKey is QAUBZVPXJJHKCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21ClN4O2/c24-16-3-1-2-15(11-16)19-12-18(23(25)29)22-21(26-19)17-5-4-14(10-20(17)27-22)13-28-6-8-30-9-7-28/h1-5,10-12,27H,6-9,13H2,(H2,25,29).
What are the key properties of 2-(3-chlorophenyl)-7-(morpholin-4-ylmethyl)-5H-pyrido[3,2-b]indole-4-carboxamide?
2-(3-chlorophenyl)-7-(morpholin-4-ylmethyl)-5H-pyrido[3,2-b]indole-4-carboxamide has a molecular weight of 420.90 g/mol, XLogP of 3.97, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenyl)-7-(morpholin-4-ylmethyl)-5H-pyrido[3,2-b]indole-4-carboxamide is sourced from PubChem (CID 66604426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).