C26H27N5O4 — CID 66608729
3-[3-methoxy-4-(2-methyl-1,3-oxazol-5-yl)phenyl]-N-(4-methoxyphenyl)-8-methyl-6,7-dihydro-5H-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide (PubChem CID 66608729) has the molecular formula C26H27N5O4 and a molecular weight of 473.53 g/mol. Its IUPAC name is 3-[3-methoxy-4-(2-methyl-1,3-oxazol-5-yl)phenyl]-N-(4-methoxyphenyl)-8-methyl-6,7-dihydro-5H-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide.
| Compound Name | 3-[3-methoxy-4-(2-methyl-1,3-oxazol-5-yl)phenyl]-N-(4-methoxyphenyl)-8-methyl-6,7-dihydro-5H-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide |
|---|---|
| PubChem CID | 66608729 |
| Molecular Formula | C26H27N5O4 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 3-[3-methoxy-4-(2-methyl-1,3-oxazol-5-yl)phenyl]-N-(4-methoxyphenyl)-8-methyl-6,7-dihydro-5H-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide |
| SMILES | COc1ccc(NC(=O)C2(C)CCCn3c(-c4ccc(-c5cnc(C)o5)c(OC)c4)nnc32)cc1 |
| InChI | InChI=1S/C26H27N5O4/c1-16-27-15-22(35-16)20-11-6-17(14-21(20)34-4)23-29-30-24-26(2,12-5-13-31(23)24)25(32)28-18-7-9-19(33-3)10-8-18/h6-11,14-15H,5,12-13H2,1-4H3,(H,28,32) |
| InChIKey | XEPBCWOZWAXLCX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |