C17H17N5O3S — CID 66610560
1-[4-(1-methylpyrazol-4-yl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 66610560) has the molecular formula C17H17N5O3S and a molecular weight of 371.42 g/mol. Its IUPAC name is 1-[4-(1-methylpyrazol-4-yl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-(1-methylpyrazol-4-yl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 66610560 |
| Molecular Formula | C17H17N5O3S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 1-[4-(1-methylpyrazol-4-yl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | Cn1cc(S(=O)(=O)c2ccc(NC(=O)NCc3cccnc3)cc2)cn1 |
| InChI | InChI=1S/C17H17N5O3S/c1-22-12-16(11-20-22)26(24,25)15-6-4-14(5-7-15)21-17(23)19-10-13-3-2-8-18-9-13/h2-9,11-12H,10H2,1H3,(H2,19,21,23) |
| InChIKey | GTUQQBFBMXKTLL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |