C20H17F2N3O4S — CID 66611183
1-[4-(2,5-difluoro-4-methoxyphenyl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 66611183) has the molecular formula C20H17F2N3O4S and a molecular weight of 433.44 g/mol. Its IUPAC name is 1-[4-(2,5-difluoro-4-methoxyphenyl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-(2,5-difluoro-4-methoxyphenyl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 66611183 |
| Molecular Formula | C20H17F2N3O4S |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 1-[4-(2,5-difluoro-4-methoxyphenyl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | COc1cc(F)c(S(=O)(=O)c2ccc(NC(=O)NCc3cccnc3)cc2)cc1F |
| InChI | InChI=1S/C20H17F2N3O4S/c1-29-18-9-17(22)19(10-16(18)21)30(27,28)15-6-4-14(5-7-15)25-20(26)24-12-13-3-2-8-23-11-13/h2-11H,12H2,1H3,(H2,24,25,26) |
| InChIKey | IYEMMWXRAFOJEZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |