C21H18F3N5O3S — CID 78225501
[(pyridin-4-ylamino)-[[4-[3-(trifluoromethoxy)phenyl]sulfonylphenyl]methylamino]methyl]cyanamide (PubChem CID 78225501) has the molecular formula C21H18F3N5O3S and a molecular weight of 477.47 g/mol. Its IUPAC name is [(pyridin-4-ylamino)-[[4-[3-(trifluoromethoxy)phenyl]sulfonylphenyl]methylamino]methyl]cyanamide.
| Compound Name | [(pyridin-4-ylamino)-[[4-[3-(trifluoromethoxy)phenyl]sulfonylphenyl]methylamino]methyl]cyanamide |
|---|---|
| PubChem CID | 78225501 |
| Molecular Formula | C21H18F3N5O3S |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | [(pyridin-4-ylamino)-[[4-[3-(trifluoromethoxy)phenyl]sulfonylphenyl]methylamino]methyl]cyanamide |
| SMILES | N#CNC(NCc1ccc(S(=O)(=O)c2cccc(OC(F)(F)F)c2)cc1)Nc1ccncc1 |
| InChI | InChI=1S/C21H18F3N5O3S/c22-21(23,24)32-17-2-1-3-19(12-17)33(30,31)18-6-4-15(5-7-18)13-27-20(28-14-25)29-16-8-10-26-11-9-16/h1-12,20,27-28H,13H2,(H,26,29) |
| InChIKey | WBBOBFWTRYPKRK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|