C20H18FN3O4S — CID 66611681
1-[4-(3-fluoro-4-methoxyphenyl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 66611681) has the molecular formula C20H18FN3O4S and a molecular weight of 415.45 g/mol. Its IUPAC name is 1-[4-(3-fluoro-4-methoxyphenyl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-(3-fluoro-4-methoxyphenyl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 66611681 |
| Molecular Formula | C20H18FN3O4S |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 1-[4-(3-fluoro-4-methoxyphenyl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | COc1ccc(S(=O)(=O)c2ccc(NC(=O)NCc3cccnc3)cc2)cc1F |
| InChI | InChI=1S/C20H18FN3O4S/c1-28-19-9-8-17(11-18(19)21)29(26,27)16-6-4-15(5-7-16)24-20(25)23-13-14-3-2-10-22-12-14/h2-12H,13H2,1H3,(H2,23,24,25) |
| InChIKey | PBWQCCXBDMKIDW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |