C27H26F3N3O5 — CID 66616755
[(3S)-3-[(3-methoxybenzoyl)amino]oxolan-3-yl] N-[[4-[2-(trifluoromethyl)anilino]phenyl]methyl]carbamate (PubChem CID 66616755) has the molecular formula C27H26F3N3O5 and a molecular weight of 529.52 g/mol. Its IUPAC name is [(3S)-3-[(3-methoxybenzoyl)amino]oxolan-3-yl] N-[[4-[2-(trifluoromethyl)anilino]phenyl]methyl]carbamate.
| Compound Name | [(3S)-3-[(3-methoxybenzoyl)amino]oxolan-3-yl] N-[[4-[2-(trifluoromethyl)anilino]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 66616755 |
| Molecular Formula | C27H26F3N3O5 |
| Molecular Weight | 529.52 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | [(3S)-3-[(3-methoxybenzoyl)amino]oxolan-3-yl] N-[[4-[2-(trifluoromethyl)anilino]phenyl]methyl]carbamate |
| SMILES | COc1cccc(C(=O)N[C@]2(OC(=O)NCc3ccc(Nc4ccccc4C(F)(F)F)cc3)CCOC2)c1 |
| InChI | InChI=1S/C27H26F3N3O5/c1-36-21-6-4-5-19(15-21)24(34)33-26(13-14-37-17-26)38-25(35)31-16-18-9-11-20(12-10-18)32-23-8-3-2-7-22(23)27(28,29)30/h2-12,15,32H,13-14,16-17H2,1H3,(H,31,35)(H,33,34)/t26-/m0/s1 |
| InChIKey | PWQJCWAMSPGMMP-SANMLTNESA-N |
| XLogP | 5.23 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.52 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|