C19H30O2 — CID 66616768
[(8R,9S,10S,13S,14S)-10-methyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-13-yl]methanediol (PubChem CID 66616768) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is [(8R,9S,10S,13S,14S)-10-methyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-13-yl]methanediol.
| Compound Name | [(8R,9S,10S,13S,14S)-10-methyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-13-yl]methanediol |
|---|---|
| PubChem CID | 66616768 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | [(8R,9S,10S,13S,14S)-10-methyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-13-yl]methanediol |
| SMILES | C[C@]12CCCCC1CC[C@@H]1[C@@H]2CC[C@]2(C(O)O)C=CC[C@@H]12 |
| InChI | InChI=1S/C19H30O2/c1-18-10-3-2-5-13(18)7-8-14-15(18)9-12-19(17(20)21)11-4-6-16(14)19/h4,11,13-17,20-21H,2-3,5-10,12H2,1H3/t13?,14-,15+,16+,18+,19-/m1/s1 |
| InChIKey | HMFFMYJPAXHECM-ACSWZETESA-N |
| XLogP | 3.88 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|