C12H11F4NO — CID 66618900
2-[2-fluoro-4-(trifluoromethyl)phenyl]-5-hydroxypentanenitrile (PubChem CID 66618900) has the molecular formula C12H11F4NO and a molecular weight of 261.22 g/mol. Its IUPAC name is 2-[2-fluoro-4-(trifluoromethyl)phenyl]-5-hydroxypentanenitrile.
| Compound Name | 2-[2-fluoro-4-(trifluoromethyl)phenyl]-5-hydroxypentanenitrile |
|---|---|
| PubChem CID | 66618900 |
| Molecular Formula | C12H11F4NO |
| Molecular Weight | 261.22 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2-[2-fluoro-4-(trifluoromethyl)phenyl]-5-hydroxypentanenitrile |
| SMILES | N#CC(CCCO)c1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C12H11F4NO/c13-11-6-9(12(14,15)16)3-4-10(11)8(7-17)2-1-5-18/h3-4,6,8,18H,1-2,5H2 |
| InChIKey | JZYYUAPVQLHOEC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.22 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |