C21H22N4O4 — CID 66619926
benzyl-[(3R)-3-[(3-nitroquinolin-4-yl)amino]butyl]carbamic acid (PubChem CID 66619926) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is benzyl-[(3R)-3-[(3-nitroquinolin-4-yl)amino]butyl]carbamic acid.
| Compound Name | benzyl-[(3R)-3-[(3-nitroquinolin-4-yl)amino]butyl]carbamic acid |
|---|---|
| PubChem CID | 66619926 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | benzyl-[(3R)-3-[(3-nitroquinolin-4-yl)amino]butyl]carbamic acid |
| SMILES | C[C@H](CCN(Cc1ccccc1)C(=O)O)Nc1c([N+](=O)[O-])cnc2ccccc12 |
| InChI | InChI=1S/C21H22N4O4/c1-15(11-12-24(21(26)27)14-16-7-3-2-4-8-16)23-20-17-9-5-6-10-18(17)22-13-19(20)25(28)29/h2-10,13,15H,11-12,14H2,1H3,(H,22,23)(H,26,27)/t15-/m1/s1 |
| InChIKey | XRRUMJBHPWFALC-OAHLLOKOSA-N |
| XLogP | 4.51 |
| TPSA | 108.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|