C18H24BrN3O3 — CID 66620330
tert-butyl 3-[amino-(4-bromophenyl)carbamoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 66620330) has the molecular formula C18H24BrN3O3 and a molecular weight of 410.31 g/mol. Its IUPAC name is tert-butyl 3-[amino-(4-bromophenyl)carbamoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl 3-[amino-(4-bromophenyl)carbamoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 66620330 |
| Molecular Formula | C18H24BrN3O3 |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | tert-butyl 3-[amino-(4-bromophenyl)carbamoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC(C2)C1C(=O)N(N)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H24BrN3O3/c1-18(2,3)25-17(24)21-14-7-4-11(10-14)15(21)16(23)22(20)13-8-5-12(19)6-9-13/h5-6,8-9,11,14-15H,4,7,10,20H2,1-3H3 |
| InChIKey | RNMZMTLFBKUTEN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|