C29H39N3O3 — CID 66621495
N'-(4-benzyl-4-morpholin-4-ylcyclohexyl)-N-[(3-methylphenyl)methyl]butanediamide (PubChem CID 66621495) has the molecular formula C29H39N3O3 and a molecular weight of 477.65 g/mol. Its IUPAC name is N'-(4-benzyl-4-morpholin-4-ylcyclohexyl)-N-[(3-methylphenyl)methyl]butanediamide.
| Compound Name | N'-(4-benzyl-4-morpholin-4-ylcyclohexyl)-N-[(3-methylphenyl)methyl]butanediamide |
|---|---|
| PubChem CID | 66621495 |
| Molecular Formula | C29H39N3O3 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | N'-(4-benzyl-4-morpholin-4-ylcyclohexyl)-N-[(3-methylphenyl)methyl]butanediamide |
| SMILES | Cc1cccc(CNC(=O)CCC(=O)NC2CCC(Cc3ccccc3)(N3CCOCC3)CC2)c1 |
| InChI | InChI=1S/C29H39N3O3/c1-23-6-5-9-25(20-23)22-30-27(33)10-11-28(34)31-26-12-14-29(15-13-26,32-16-18-35-19-17-32)21-24-7-3-2-4-8-24/h2-9,20,26H,10-19,21-22H2,1H3,(H,30,33)(H,31,34) |
| InChIKey | IXKVCAJVEHFSBI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |