C27H32F3N5O2S — CID 66622073
3-methyl-2-[1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetyl]piperidin-4-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2H-1,3-thiazole-4-carboxamide (PubChem CID 66622073) has the molecular formula C27H32F3N5O2S and a molecular weight of 547.65 g/mol. Its IUPAC name is 3-methyl-2-[1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetyl]piperidin-4-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2H-1,3-thiazole-4-carboxamide.
| Compound Name | 3-methyl-2-[1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetyl]piperidin-4-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2H-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 66622073 |
| Molecular Formula | C27H32F3N5O2S |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | 3-methyl-2-[1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetyl]piperidin-4-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2H-1,3-thiazole-4-carboxamide |
| SMILES | Cc1cc(C(F)(F)F)nn1CC(=O)N1CCC(C2SC=C(C(=O)NC3CCCc4ccccc43)N2C)CC1 |
| InChI | InChI=1S/C27H32F3N5O2S/c1-17-14-23(27(28,29)30)32-35(17)15-24(36)34-12-10-19(11-13-34)26-33(2)22(16-38-26)25(37)31-21-9-5-7-18-6-3-4-8-20(18)21/h3-4,6,8,14,16,19,21,26H,5,7,9-13,15H2,1-2H3,(H,31,37) |
| InChIKey | HSQXUYXUXRNPBL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |