C18H22N4O2 — CID 666243
5-methyl-3-(3-morpholin-4-ylpropyl)pyrimido[5,4-b]indol-4-one (PubChem CID 666243) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 5-methyl-3-(3-morpholin-4-ylpropyl)pyrimido[5,4-b]indol-4-one.
| Compound Name | 5-methyl-3-(3-morpholin-4-ylpropyl)pyrimido[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 666243 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 5-methyl-3-(3-morpholin-4-ylpropyl)pyrimido[5,4-b]indol-4-one |
| SMILES | Cn1c2ccccc2c2ncn(CCCN3CCOCC3)c(=O)c21 |
| InChI | InChI=1S/C18H22N4O2/c1-20-15-6-3-2-5-14(15)16-17(20)18(23)22(13-19-16)8-4-7-21-9-11-24-12-10-21/h2-3,5-6,13H,4,7-12H2,1H3 |
| InChIKey | JBWFQVOWADATKL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 52.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |