C18H26O5 — CID 66626097
2-butan-2-yloxycarbonyl-4-(3-methoxyphenyl)-3,3-dimethylbutanoic acid (PubChem CID 66626097) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is 2-butan-2-yloxycarbonyl-4-(3-methoxyphenyl)-3,3-dimethylbutanoic acid.
| Compound Name | 2-butan-2-yloxycarbonyl-4-(3-methoxyphenyl)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 66626097 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2-butan-2-yloxycarbonyl-4-(3-methoxyphenyl)-3,3-dimethylbutanoic acid |
| SMILES | CCC(C)OC(=O)C(C(=O)O)C(C)(C)Cc1cccc(OC)c1 |
| InChI | InChI=1S/C18H26O5/c1-6-12(2)23-17(21)15(16(19)20)18(3,4)11-13-8-7-9-14(10-13)22-5/h7-10,12,15H,6,11H2,1-5H3,(H,19,20) |
| InChIKey | AEAVSLGJBHUWQI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|